C24H36FN5O4 — CID 142956021
(6S)-6-butyl-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 142956021) has the molecular formula C24H36FN5O4 and a molecular weight of 477.58 g/mol. Its IUPAC name is (6S)-6-butyl-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-6-butyl-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 142956021 |
| Molecular Formula | C24H36FN5O4 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | (6S)-6-butyl-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCC[C@H]1C(=O)N(CCCOC)CC2N1C(=O)CN(C)N2C(=O)NCC1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C24H36FN5O4/c1-4-5-10-20-23(32)28(13-7-14-34-3)16-21-29(20)22(31)17-27(2)30(21)24(33)26-15-18-8-6-9-19(25)12-11-18/h8-9,11-12,20-21H,4-7,10,13-17H2,1-3H3,(H,26,33)/t20-,21?/m0/s1 |
| InChIKey | JCVXZGOHNJWNRI-BGERDNNASA-N |
| XLogP | 2.19 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|