C25H35N5O3S2 — CID 142956730
(6S)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine (PubChem CID 142956730) has the molecular formula C25H35N5O3S2 and a molecular weight of 517.72 g/mol. Its IUPAC name is (6S)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine.
| Compound Name | (6S)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 142956730 |
| Molecular Formula | C25H35N5O3S2 |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | (6S)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine |
| SMILES | CNCc1ccccc1.CSCC[C@H]1C(=O)N(CCc2cccs2)CC2N1C(=O)CN(C)N2C=O |
| InChI | InChI=1S/C17H24N4O3S2.C8H11N/c1-18-11-16(23)21-14(6-9-25-2)17(24)19(10-15(21)20(18)12-22)7-5-13-4-3-8-26-13;1-9-7-8-5-3-2-4-6-8/h3-4,8,12,14-15H,5-7,9-11H2,1-2H3;2-6,9H,7H2,1H3/t14-,15?;/m0./s1 |
| InChIKey | DVKMDTFBMXMOOC-QDVCFFRGSA-N |
| XLogP | 2.13 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|