C27H35N5O3S — CID 143145957
(6S,9aS)-N-benzyl-2-ethyl-6-(3-methylbut-3-enyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145957) has the molecular formula C27H35N5O3S and a molecular weight of 509.68 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-2-ethyl-6-(3-methylbut-3-enyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-2-ethyl-6-(3-methylbut-3-enyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145957 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | (6S,9aS)-N-benzyl-2-ethyl-6-(3-methylbut-3-enyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=C(C)CC[C@H]1C(=O)N(CCc2cccs2)C[C@H]2N1C(=O)CN(CC)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H35N5O3S/c1-4-30-19-25(33)31-23(13-12-20(2)3)26(34)29(15-14-22-11-8-16-36-22)18-24(31)32(30)27(35)28-17-21-9-6-5-7-10-21/h5-11,16,23-24H,2,4,12-15,17-19H2,1,3H3,(H,28,35)/t23-,24-/m0/s1 |
| InChIKey | ZJBUELITHLWURU-ZEQRLZLVSA-N |
| XLogP | 3.47 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|