C23H27N5O5S — CID 71218797
3-[(6S,9aS)-1-(benzylcarbamoyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid (PubChem CID 71218797) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is 3-[(6S,9aS)-1-(benzylcarbamoyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid.
| Compound Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 71218797 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-4,7-dioxo-8-(2-thiophen-2-ylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1C(=O)N(CCc2cccs2)C[C@@H]2N(C(=O)NCc3ccccc3)NCC(=O)N21 |
| InChI | InChI=1S/C23H27N5O5S/c29-20-14-25-28(23(33)24-13-16-5-2-1-3-6-16)19-15-26(11-10-17-7-4-12-34-17)22(32)18(27(19)20)8-9-21(30)31/h1-7,12,18-19,25H,8-11,13-15H2,(H,24,33)(H,30,31)/t18-,19-/m0/s1 |
| InChIKey | YSINDJXPUDOOLT-OALUTQOASA-N |
| XLogP | 1.25 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |