C33H32N6O4 — CID 89386928
(6S,9aS)-N-benzyl-6-[(4-formamidophenyl)methyl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 89386928) has the molecular formula C33H32N6O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-[(4-formamidophenyl)methyl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-[(4-formamidophenyl)methyl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 89386928 |
| Molecular Formula | C33H32N6O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-[(4-formamidophenyl)methyl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | O=CNc1ccc(C[C@H]2C(=O)N(Cc3cccc4ccccc34)C[C@@H]3N(C(=O)NCc4ccccc4)NCC(=O)N32)cc1 |
| InChI | InChI=1S/C33H32N6O4/c40-22-35-27-15-13-23(14-16-27)17-29-32(42)37(20-26-11-6-10-25-9-4-5-12-28(25)26)21-30-38(29)31(41)19-36-39(30)33(43)34-18-24-7-2-1-3-8-24/h1-16,22,29-30,36H,17-21H2,(H,34,43)(H,35,40)/t29-,30-/m0/s1 |
| InChIKey | LRCHVHQTIDENKD-KYJUHHDHSA-N |
| XLogP | 3.25 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|