C32H30N6O5 — CID 71189404
1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-5-[(4-nitrophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzylurea (PubChem CID 71189404) has the molecular formula C32H30N6O5 and a molecular weight of 578.63 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-5-[(4-nitrophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzylurea.
| Compound Name | 1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-5-[(4-nitrophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzylurea |
|---|---|
| PubChem CID | 71189404 |
| Molecular Formula | C32H30N6O5 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-5-[(4-nitrophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzylurea |
| SMILES | O=C(NCc1ccccc1)NN1CC(=O)N2[C@@H]1CN(Cc1cccc3ccccc13)C(=O)[C@@H]2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H30N6O5/c39-30-21-36(34-32(41)33-18-23-7-2-1-3-8-23)29-20-35(19-25-11-6-10-24-9-4-5-12-27(24)25)31(40)28(37(29)30)17-22-13-15-26(16-14-22)38(42)43/h1-16,28-29H,17-21H2,(H2,33,34,41)/t28-,29+/m0/s1 |
| InChIKey | UYNQDRMIJDRFHA-URLMMPGGSA-N |
| XLogP | 3.59 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|