C34H32N4O5 — CID 89494501
[4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] formate (PubChem CID 89494501) has the molecular formula C34H32N4O5 and a molecular weight of 576.65 g/mol. Its IUPAC name is [4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] formate.
| Compound Name | [4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] formate |
|---|---|
| PubChem CID | 89494501 |
| Molecular Formula | C34H32N4O5 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | [4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] formate |
| SMILES | O=COc1ccc(C[C@H]2C(=O)N(Cc3cccc4ccccc34)C[C@@H]3N(C(=O)NCc4ccccc4)CCC(=O)N32)cc1 |
| InChI | InChI=1S/C34H32N4O5/c39-23-43-28-15-13-24(14-16-28)19-30-33(41)36(21-27-11-6-10-26-9-4-5-12-29(26)27)22-31-37(18-17-32(40)38(30)31)34(42)35-20-25-7-2-1-3-8-25/h1-16,23,30-31H,17-22H2,(H,35,42)/t30-,31+/m0/s1 |
| InChIKey | LZWUYPSMAQIFJG-IOWSJCHKSA-N |
| XLogP | 4.10 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|