C38H40N4O5 — CID 71548048
[4-[[(6S)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] pentanoate (PubChem CID 71548048) has the molecular formula C38H40N4O5 and a molecular weight of 632.76 g/mol. Its IUPAC name is [4-[[(6S)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] pentanoate.
| Compound Name | [4-[[(6S)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] pentanoate |
|---|---|
| PubChem CID | 71548048 |
| Molecular Formula | C38H40N4O5 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | [4-[[(6S)-1-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(C[C@H]2C(=O)N(Cc3cccc4ccccc34)CC3N(C(=O)NCc4ccccc4)CCC(=O)N32)cc1 |
| InChI | InChI=1S/C38H40N4O5/c1-2-3-16-36(44)47-31-19-17-27(18-20-31)23-33-37(45)40(25-30-14-9-13-29-12-7-8-15-32(29)30)26-34-41(22-21-35(43)42(33)34)38(46)39-24-28-10-5-4-6-11-28/h4-15,17-20,33-34H,2-3,16,21-26H2,1H3,(H,39,46)/t33-,34?/m0/s1 |
| InChIKey | AWVRPXJXQBMMCJ-CDRRMRQFSA-N |
| XLogP | 5.66 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|