C31H34N4O5 — CID 177372124
(6S,9aS)-N-(1,3-benzodioxol-5-ylmethyl)-6-[(2S)-butan-2-yl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide (PubChem CID 177372124) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is (6S,9aS)-N-(1,3-benzodioxol-5-ylmethyl)-6-[(2S)-butan-2-yl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide.
| Compound Name | (6S,9aS)-N-(1,3-benzodioxol-5-ylmethyl)-6-[(2S)-butan-2-yl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 177372124 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | (6S,9aS)-N-(1,3-benzodioxol-5-ylmethyl)-6-[(2S)-butan-2-yl]-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
| SMILES | CC[C@H](C)[C@H]1C(=O)N(Cc2cccc3ccccc23)C[C@@H]2N(C(=O)NCc3ccc4c(c3)OCO4)CCC(=O)N12 |
| InChI | InChI=1S/C31H34N4O5/c1-3-20(2)29-30(37)33(17-23-9-6-8-22-7-4-5-10-24(22)23)18-27-34(14-13-28(36)35(27)29)31(38)32-16-21-11-12-25-26(15-21)40-19-39-25/h4-12,15,20,27,29H,3,13-14,16-19H2,1-2H3,(H,32,38)/t20-,27+,29-/m0/s1 |
| InChIKey | PHMQHDGOZOOPDU-XHGLXQHVSA-N |
| XLogP | 4.10 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |