C42H48N4O5 — CID 123986102
[4-[[(6S)-6-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2,3,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] nonanoate (PubChem CID 123986102) has the molecular formula C42H48N4O5 and a molecular weight of 688.87 g/mol. Its IUPAC name is [4-[[(6S)-6-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2,3,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] nonanoate.
| Compound Name | [4-[[(6S)-6-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2,3,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] nonanoate |
|---|---|
| PubChem CID | 123986102 |
| Molecular Formula | C42H48N4O5 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | [4-[[(6S)-6-(benzylcarbamoyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2,3,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrimidin-6-yl]methyl]phenyl] nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1ccc(C[C@]2(C(=O)NCc3ccccc3)C(=O)N(Cc3cccc4ccccc34)CC3NCCC(=O)N32)cc1 |
| InChI | InChI=1S/C42H48N4O5/c1-2-3-4-5-6-10-20-39(48)51-35-23-21-31(22-24-35)27-42(40(49)44-28-32-14-8-7-9-15-32)41(50)45(30-37-43-26-25-38(47)46(37)42)29-34-18-13-17-33-16-11-12-19-36(33)34/h7-9,11-19,21-24,37,43H,2-6,10,20,25-30H2,1H3,(H,44,49)/t37?,42-/m0/s1 |
| InChIKey | ASVNUUROPRFEAP-AKGPCBEQSA-N |
| XLogP | 6.28 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|