C43H37N3O — CID 130250024
(1S)-1-(N-[4-methyl-4-[2-(4-phenylanilino)carbazol-9-yl]cyclohexa-1,5-dien-1-yl]anilino)cyclohexa-2,4-dien-1-ol (PubChem CID 130250024) has the molecular formula C43H37N3O and a molecular weight of 611.79 g/mol. Its IUPAC name is (1S)-1-(N-[4-methyl-4-[2-(4-phenylanilino)carbazol-9-yl]cyclohexa-1,5-dien-1-yl]anilino)cyclohexa-2,4-dien-1-ol.
| Compound Name | (1S)-1-(N-[4-methyl-4-[2-(4-phenylanilino)carbazol-9-yl]cyclohexa-1,5-dien-1-yl]anilino)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 130250024 |
| Molecular Formula | C43H37N3O |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | (1S)-1-(N-[4-methyl-4-[2-(4-phenylanilino)carbazol-9-yl]cyclohexa-1,5-dien-1-yl]anilino)cyclohexa-2,4-dien-1-ol |
| SMILES | CC1(n2c3ccccc3c3ccc(Nc4ccc(-c5ccccc5)cc4)cc32)C=CC(N(c2ccccc2)[C@@]2(O)C=CC=CC2)=CC1 |
| InChI | InChI=1S/C43H37N3O/c1-42(29-25-37(26-30-42)45(36-15-7-3-8-16-36)43(47)27-11-4-12-28-43)46-40-18-10-9-17-38(40)39-24-23-35(31-41(39)46)44-34-21-19-33(20-22-34)32-13-5-2-6-14-32/h2-27,29,31,44,47H,28,30H2,1H3/t42?,43-/m1/s1 |
| InChIKey | FKOSEBYYAMYUPZ-XFCPCMSTSA-N |
| XLogP | 10.48 |
| TPSA | 40.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|