C21H33NO — CID 130252090
(2R,3S,11bR)-2-(methoxymethyl)-9,10-dimethyl-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine (PubChem CID 130252090) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (2R,3S,11bR)-2-(methoxymethyl)-9,10-dimethyl-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine.
| Compound Name | (2R,3S,11bR)-2-(methoxymethyl)-9,10-dimethyl-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 130252090 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (2R,3S,11bR)-2-(methoxymethyl)-9,10-dimethyl-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
| SMILES | COC[C@@H]1C[C@@H]2c3cc(C)c(C)cc3CCN2C[C@H]1CC(C)C |
| InChI | InChI=1S/C21H33NO/c1-14(2)8-18-12-22-7-6-17-9-15(3)16(4)10-20(17)21(22)11-19(18)13-23-5/h9-10,14,18-19,21H,6-8,11-13H2,1-5H3/t18-,19+,21-/m1/s1 |
| InChIKey | FANZXOHVQVLYSU-SVFBPWRDSA-N |
| XLogP | 4.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |