C28H37FN2O4 — CID 130252387
2-[(2S,3R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxyphenyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid (PubChem CID 130252387) has the molecular formula C28H37FN2O4 and a molecular weight of 484.61 g/mol. Its IUPAC name is 2-[(2S,3R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxyphenyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxyphenyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 130252387 |
| Molecular Formula | C28H37FN2O4 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 2-[(2S,3R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxyphenyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid |
| SMILES | CCOc1ccc(F)c(N2CCC(Oc3ccc(N4C[C@H](C)[C@@H](C)[C@@H]4CC(=O)O)cc3)C(C)C2)c1 |
| InChI | InChI=1S/C28H37FN2O4/c1-5-34-23-10-11-24(29)26(14-23)30-13-12-27(19(3)16-30)35-22-8-6-21(7-9-22)31-17-18(2)20(4)25(31)15-28(32)33/h6-11,14,18-20,25,27H,5,12-13,15-17H2,1-4H3,(H,32,33)/t18-,19?,20+,25-,27?/m0/s1 |
| InChIKey | AVNZKQPFXKINHX-UFELELQDSA-N |
| XLogP | 5.45 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|