C26H33FN2O4 — CID 130252283
2-[(2R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid (PubChem CID 130252283) has the molecular formula C26H33FN2O4 and a molecular weight of 456.56 g/mol. Its IUPAC name is 2-[(2R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 130252283 |
| Molecular Formula | C26H33FN2O4 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[(2R,4R)-1-[4-[1-(5-ethoxy-2-fluorophenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid |
| SMILES | CCOc1ccc(F)c(N2CCC(Oc3ccc(N4C[C@H](C)C[C@@H]4CC(=O)O)cc3)CC2)c1 |
| InChI | InChI=1S/C26H33FN2O4/c1-3-32-23-8-9-24(27)25(16-23)28-12-10-22(11-13-28)33-21-6-4-19(5-7-21)29-17-18(2)14-20(29)15-26(30)31/h4-9,16,18,20,22H,3,10-15,17H2,1-2H3,(H,30,31)/t18-,20-/m1/s1 |
| InChIKey | CVHOIYRCWQWZEJ-UYAOXDASSA-N |
| XLogP | 4.96 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|