C27H35FN2O5 — CID 123652156
2-[1-[4-[1-(2-fluoro-5-methoxyphenyl)-3,5-dimethylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid (PubChem CID 123652156) has the molecular formula C27H35FN2O5 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-[1-[4-[1-(2-fluoro-5-methoxyphenyl)-3,5-dimethylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[4-[1-(2-fluoro-5-methoxyphenyl)-3,5-dimethylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 123652156 |
| Molecular Formula | C27H35FN2O5 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 2-[1-[4-[1-(2-fluoro-5-methoxyphenyl)-3,5-dimethylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid |
| SMILES | COc1ccc(F)c(N2CC(C)C(Oc3ccc(N4CC(OC)CC4CC(=O)O)cc3)C(C)C2)c1 |
| InChI | InChI=1S/C27H35FN2O5/c1-17-14-29(25-13-22(33-3)9-10-24(25)28)15-18(2)27(17)35-21-7-5-19(6-8-21)30-16-23(34-4)11-20(30)12-26(31)32/h5-10,13,17-18,20,23,27H,11-12,14-16H2,1-4H3,(H,31,32) |
| InChIKey | LEYHSNXATXEENR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|