C25H32ClN3O5 — CID 144629716
2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid (PubChem CID 144629716) has the molecular formula C25H32ClN3O5 and a molecular weight of 490.00 g/mol. Its IUPAC name is 2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 144629716 |
| Molecular Formula | C25H32ClN3O5 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-methoxypyrrolidin-2-yl]acetic acid |
| SMILES | COc1cc(N2CCC(Oc3ccc(N4CC(OC)CC4CC(=O)O)cc3)C(C)C2)c(Cl)cn1 |
| InChI | InChI=1S/C25H32ClN3O5/c1-16-14-28(22-12-24(33-3)27-13-21(22)26)9-8-23(16)34-19-6-4-17(5-7-19)29-15-20(32-2)10-18(29)11-25(30)31/h4-7,12-13,16,18,20,23H,8-11,14-15H2,1-3H3,(H,30,31) |
| InChIKey | ZHGRGAYWQLUIEP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|