C29H37ClF3N3O5 — CID 171353914
2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methyl-4-(4,4,4-trifluorobutoxy)pyrrolidin-2-yl]acetic acid (PubChem CID 171353914) has the molecular formula C29H37ClF3N3O5 and a molecular weight of 600.08 g/mol. Its IUPAC name is 2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methyl-4-(4,4,4-trifluorobutoxy)pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methyl-4-(4,4,4-trifluorobutoxy)pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 171353914 |
| Molecular Formula | C29H37ClF3N3O5 |
| Molecular Weight | 600.08 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methyl-4-(4,4,4-trifluorobutoxy)pyrrolidin-2-yl]acetic acid |
| SMILES | COc1cc(N2CC[C@@H](Oc3ccc(N4C[C@H](OCCCC(F)(F)F)[C@@H](C)[C@@H]4CC(=O)O)cc3)[C@H](C)C2)c(Cl)cn1 |
| InChI | InChI=1S/C29H37ClF3N3O5/c1-18-16-35(24-13-27(39-3)34-15-22(24)30)11-9-25(18)41-21-7-5-20(6-8-21)36-17-26(19(2)23(36)14-28(37)38)40-12-4-10-29(31,32)33/h5-8,13,15,18-19,23,25-26H,4,9-12,14,16-17H2,1-3H3,(H,37,38)/t18-,19+,23+,25-,26+/m1/s1 |
| InChIKey | HHDSNECEJSAVMZ-HQHTXKLGSA-N |
| XLogP | 6.06 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.08 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|