C30H42ClN3O6 — CID 171350813
2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-ethoxypropoxy)-3-methylpyrrolidin-2-yl]acetic acid (PubChem CID 171350813) has the molecular formula C30H42ClN3O6 and a molecular weight of 576.13 g/mol. Its IUPAC name is 2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-ethoxypropoxy)-3-methylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-ethoxypropoxy)-3-methylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 171350813 |
| Molecular Formula | C30H42ClN3O6 |
| Molecular Weight | 576.13 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 2-[(2S,3S,4R)-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-ethoxypropoxy)-3-methylpyrrolidin-2-yl]acetic acid |
| SMILES | CCOCCCO[C@H]1CN(c2ccc(O[C@@H]3CCN(c4cc(OC)ncc4Cl)C[C@H]3C)cc2)[C@@H](CC(=O)O)[C@@H]1C |
| InChI | InChI=1S/C30H42ClN3O6/c1-5-38-13-6-14-39-28-19-34(25(21(28)3)16-30(35)36)22-7-9-23(10-8-22)40-27-11-12-33(18-20(27)2)26-15-29(37-4)32-17-24(26)31/h7-10,15,17,20-21,25,27-28H,5-6,11-14,16,18-19H2,1-4H3,(H,35,36)/t20-,21+,25+,27-,28+/m1/s1 |
| InChIKey | VLETZPKCWFWFDY-ICOBGVNFSA-N |
| XLogP | 5.15 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.13 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|