C29H41ClN4O4 — CID 118505399
2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetamide (PubChem CID 118505399) has the molecular formula C29H41ClN4O4 and a molecular weight of 545.12 g/mol. Its IUPAC name is 2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetamide.
| Compound Name | 2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetamide |
|---|---|
| PubChem CID | 118505399 |
| Molecular Formula | C29H41ClN4O4 |
| Molecular Weight | 545.12 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | 2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetamide |
| SMILES | CCCCO[C@H]1CN(c2ccc(O[C@@H]3CCN(c4cc(OC)ncc4Cl)C[C@H]3C)cc2)[C@@H](CC(N)=O)[C@@H]1C |
| InChI | InChI=1S/C29H41ClN4O4/c1-5-6-13-37-27-18-34(24(20(27)3)14-28(31)35)21-7-9-22(10-8-21)38-26-11-12-33(17-19(26)2)25-15-29(36-4)32-16-23(25)30/h7-10,15-16,19-20,24,26-27H,5-6,11-14,17-18H2,1-4H3,(H2,31,35)/t19-,20+,24+,26-,27+/m1/s1 |
| InChIKey | KAFVJPGGQKWCCB-UAVGYUILSA-N |
| XLogP | 4.92 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.12 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|