C28H39ClFN3O4 — CID 134411018
5-chloro-4-[4-[2-fluoro-4-[(2S,3S,4R)-4-(3-methoxypropoxy)-2,3-dimethylpyrrolidin-1-yl]phenoxy]-3-methylpiperidin-1-yl]-2-methoxypyridine (PubChem CID 134411018) has the molecular formula C28H39ClFN3O4 and a molecular weight of 536.09 g/mol. Its IUPAC name is 5-chloro-4-[4-[2-fluoro-4-[(2S,3S,4R)-4-(3-methoxypropoxy)-2,3-dimethylpyrrolidin-1-yl]phenoxy]-3-methylpiperidin-1-yl]-2-methoxypyridine.
| Compound Name | 5-chloro-4-[4-[2-fluoro-4-[(2S,3S,4R)-4-(3-methoxypropoxy)-2,3-dimethylpyrrolidin-1-yl]phenoxy]-3-methylpiperidin-1-yl]-2-methoxypyridine |
|---|---|
| PubChem CID | 134411018 |
| Molecular Formula | C28H39ClFN3O4 |
| Molecular Weight | 536.09 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 5-chloro-4-[4-[2-fluoro-4-[(2S,3S,4R)-4-(3-methoxypropoxy)-2,3-dimethylpyrrolidin-1-yl]phenoxy]-3-methylpiperidin-1-yl]-2-methoxypyridine |
| SMILES | COCCCO[C@H]1CN(c2ccc(OC3CCN(c4cc(OC)ncc4Cl)CC3C)c(F)c2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C28H39ClFN3O4/c1-18-16-32(24-14-28(35-5)31-15-22(24)29)10-9-25(18)37-26-8-7-21(13-23(26)30)33-17-27(19(2)20(33)3)36-12-6-11-34-4/h7-8,13-15,18-20,25,27H,6,9-12,16-17H2,1-5H3/t18?,19-,20-,25?,27-/m0/s1 |
| InChIKey | WRMIJJAJCABTHN-BRIQVWNDSA-N |
| XLogP | 5.44 |
| TPSA | 56.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.09 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|