C22H26ClF2N3O2 — CID 144629737
5-chloro-4-[4-(3,5-difluoro-4-pyrrolidin-1-ylphenoxy)-3-methylpiperidin-1-yl]-2-methoxypyridine (PubChem CID 144629737) has the molecular formula C22H26ClF2N3O2 and a molecular weight of 437.92 g/mol. Its IUPAC name is 5-chloro-4-[4-(3,5-difluoro-4-pyrrolidin-1-ylphenoxy)-3-methylpiperidin-1-yl]-2-methoxypyridine.
| Compound Name | 5-chloro-4-[4-(3,5-difluoro-4-pyrrolidin-1-ylphenoxy)-3-methylpiperidin-1-yl]-2-methoxypyridine |
|---|---|
| PubChem CID | 144629737 |
| Molecular Formula | C22H26ClF2N3O2 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 5-chloro-4-[4-(3,5-difluoro-4-pyrrolidin-1-ylphenoxy)-3-methylpiperidin-1-yl]-2-methoxypyridine |
| SMILES | COc1cc(N2CCC(Oc3cc(F)c(N4CCCC4)c(F)c3)C(C)C2)c(Cl)cn1 |
| InChI | InChI=1S/C22H26ClF2N3O2/c1-14-13-28(19-11-21(29-2)26-12-16(19)23)8-5-20(14)30-15-9-17(24)22(18(25)10-15)27-6-3-4-7-27/h9-12,14,20H,3-8,13H2,1-2H3 |
| InChIKey | OOBZRWKADJYATE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|