C29H37ClN4O5 — CID 123649689
2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-cyanopropoxy)-3-methylpyrrolidin-2-yl]acetic acid (PubChem CID 123649689) has the molecular formula C29H37ClN4O5 and a molecular weight of 557.09 g/mol. Its IUPAC name is 2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-cyanopropoxy)-3-methylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-cyanopropoxy)-3-methylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 123649689 |
| Molecular Formula | C29H37ClN4O5 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 2-[1-[4-[1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-cyanopropoxy)-3-methylpyrrolidin-2-yl]acetic acid |
| SMILES | COc1cc(N2CCC(Oc3ccc(N4CC(OCCCC#N)C(C)C4CC(=O)O)cc3)C(C)C2)c(Cl)cn1 |
| InChI | InChI=1S/C29H37ClN4O5/c1-19-17-33(25-14-28(37-3)32-16-23(25)30)12-10-26(19)39-22-8-6-21(7-9-22)34-18-27(38-13-5-4-11-31)20(2)24(34)15-29(35)36/h6-9,14,16,19-20,24,26-27H,4-5,10,12-13,15,17-18H2,1-3H3,(H,35,36) |
| InChIKey | FMCVYACWSRCBOZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|