C32H37FN2O4 — CID 130252373
2-[(2R,4R)-1-[4-[1-(2-benzyl-6-fluoro-3-methoxyphenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid (PubChem CID 130252373) has the molecular formula C32H37FN2O4 and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-[(2R,4R)-1-[4-[1-(2-benzyl-6-fluoro-3-methoxyphenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,4R)-1-[4-[1-(2-benzyl-6-fluoro-3-methoxyphenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 130252373 |
| Molecular Formula | C32H37FN2O4 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 2-[(2R,4R)-1-[4-[1-(2-benzyl-6-fluoro-3-methoxyphenyl)piperidin-4-yl]oxyphenyl]-4-methylpyrrolidin-2-yl]acetic acid |
| SMILES | COc1ccc(F)c(N2CCC(Oc3ccc(N4C[C@H](C)C[C@@H]4CC(=O)O)cc3)CC2)c1Cc1ccccc1 |
| InChI | InChI=1S/C32H37FN2O4/c1-22-18-25(20-31(36)37)35(21-22)24-8-10-26(11-9-24)39-27-14-16-34(17-15-27)32-28(19-23-6-4-3-5-7-23)30(38-2)13-12-29(32)33/h3-13,22,25,27H,14-21H2,1-2H3,(H,36,37)/t22-,25-/m1/s1 |
| InChIKey | AZKOKIAZPWRXJN-RCZVLFRGSA-N |
| XLogP | 6.16 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|