C28H39FN2O4 — CID 134405102
1-(5-ethoxy-2-fluorophenyl)-4-[4-[(3R)-3-(3-methoxypropoxy)-4-methylpyrrolidin-1-yl]phenoxy]piperidine (PubChem CID 134405102) has the molecular formula C28H39FN2O4 and a molecular weight of 486.63 g/mol. Its IUPAC name is 1-(5-ethoxy-2-fluorophenyl)-4-[4-[(3R)-3-(3-methoxypropoxy)-4-methylpyrrolidin-1-yl]phenoxy]piperidine.
| Compound Name | 1-(5-ethoxy-2-fluorophenyl)-4-[4-[(3R)-3-(3-methoxypropoxy)-4-methylpyrrolidin-1-yl]phenoxy]piperidine |
|---|---|
| PubChem CID | 134405102 |
| Molecular Formula | C28H39FN2O4 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 1-(5-ethoxy-2-fluorophenyl)-4-[4-[(3R)-3-(3-methoxypropoxy)-4-methylpyrrolidin-1-yl]phenoxy]piperidine |
| SMILES | CCOc1ccc(F)c(N2CCC(Oc3ccc(N4CC(C)[C@@H](OCCCOC)C4)cc3)CC2)c1 |
| InChI | InChI=1S/C28H39FN2O4/c1-4-33-25-10-11-26(29)27(18-25)30-14-12-24(13-15-30)35-23-8-6-22(7-9-23)31-19-21(2)28(20-31)34-17-5-16-32-3/h6-11,18,21,24,28H,4-5,12-17,19-20H2,1-3H3/t21?,28-/m0/s1 |
| InChIKey | SFWALFFRRCVUGX-QVWGJOIVSA-N |
| XLogP | 5.15 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|