C12H17NO — CID 130252489
4-(2,2-dimethylpent-3-enyl)-1H-pyridin-2-one (PubChem CID 130252489) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-(2,2-dimethylpent-3-enyl)-1H-pyridin-2-one.
| Compound Name | 4-(2,2-dimethylpent-3-enyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130252489 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(2,2-dimethylpent-3-enyl)-1H-pyridin-2-one |
| SMILES | CC=CC(C)(C)Cc1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C12H17NO/c1-4-6-12(2,3)9-10-5-7-13-11(14)8-10/h4-8H,9H2,1-3H3,(H,13,14) |
| InChIKey | HGTUKLZHCNNNSS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|