About (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene
(5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene (PubChem CID 130255115) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene.
Molecular Properties
| Compound Name | (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene |
| PubChem CID | 130255115 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene |
| SMILES | C=C1CC/C(C)=C\CCCC(C)/C=N\1 |
| InChI | InChI=1S/C13H21N/c1-11-6-4-5-7-12(2)10-14-13(3)9-8-11/h6,10,12H,3-5,7-9H2,1-2H3/b11-6-,14-10- |
| InChIKey | FNTJEQYGOZGDLB-PRUKLFJYSA-N |
| XLogP | 4.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene?
The IUPAC name of (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene (CID 130255115) is (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene.
What is the SMILES notation for (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene?
The canonical SMILES for (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene is C=C1CC/C(C)=C\CCCC(C)/C=N\1.
What is the InChIKey of (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene?
The InChIKey is FNTJEQYGOZGDLB-PRUKLFJYSA-N. The full InChI is InChI=1S/C13H21N/c1-11-6-4-5-7-12(2)10-14-13(3)9-8-11/h6,10,12H,3-5,7-9H2,1-2H3/b11-6-,14-10-.
What are the key properties of (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene?
(5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene has a molecular weight of 191.32 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5,10-dimethyl-2-methylidene-1-azacycloundeca-5,11-diene is sourced from PubChem (CID 130255115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).