C16H19IN2O2 — CID 130257037
trans-ethyl (1S,2S)-2-[4-(5-iodo-1-methyl-4,5-dihydroimidazol-4-yl)phenyl]cyclopropane-1-carboxylate (PubChem CID 130257037) has the molecular formula C16H19IN2O2 and a molecular weight of 398.24 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-[4-(5-iodo-1-methyl-4,5-dihydroimidazol-4-yl)phenyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-[4-(5-iodo-1-methyl-4,5-dihydroimidazol-4-yl)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 130257037 |
| Molecular Formula | C16H19IN2O2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | trans-ethyl (1S,2S)-2-[4-(5-iodo-1-methyl-4,5-dihydroimidazol-4-yl)phenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1c1ccc(C2N=CN(C)C2I)cc1 |
| InChI | InChI=1S/C16H19IN2O2/c1-3-21-16(20)13-8-12(13)10-4-6-11(7-5-10)14-15(17)19(2)9-18-14/h4-7,9,12-15H,3,8H2,1-2H3/t12-,13+,14?,15?/m1/s1 |
| InChIKey | XERISOYMQMEAND-DNDYEEKYSA-N |
| XLogP | 3.13 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|