C11H13ClN2OS — CID 130257470
6-chloro-3-methylsulfinyl-1-propan-2-ylpyrrolo[3,2-c]pyridine (PubChem CID 130257470) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is 6-chloro-3-methylsulfinyl-1-propan-2-ylpyrrolo[3,2-c]pyridine.
| Compound Name | 6-chloro-3-methylsulfinyl-1-propan-2-ylpyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 130257470 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 6-chloro-3-methylsulfinyl-1-propan-2-ylpyrrolo[3,2-c]pyridine |
| SMILES | CC(C)n1cc(S(C)=O)c2cnc(Cl)cc21 |
| InChI | InChI=1S/C11H13ClN2OS/c1-7(2)14-6-10(16(3)15)8-5-13-11(12)4-9(8)14/h4-7H,1-3H3 |
| InChIKey | HTIXWTHWKGBJOV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|