C21H28N12O2 — CID 130262056
4-N-[2-[5-[[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]methyl]furan-2-yl]ethyl]-2-N-[(5-methylfuran-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 130262056) has the molecular formula C21H28N12O2 and a molecular weight of 480.54 g/mol. Its IUPAC name is 4-N-[2-[5-[[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]methyl]furan-2-yl]ethyl]-2-N-[(5-methylfuran-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-[5-[[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]methyl]furan-2-yl]ethyl]-2-N-[(5-methylfuran-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 130262056 |
| Molecular Formula | C21H28N12O2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 4-N-[2-[5-[[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]methyl]furan-2-yl]ethyl]-2-N-[(5-methylfuran-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NC)nc(NCc2ccc(CCNc3nc(N)nc(NCc4ccc(C)o4)n3)o2)n1 |
| InChI | InChI=1S/C21H28N12O2/c1-12-4-5-14(34-12)10-26-20-29-16(22)28-19(33-20)25-9-8-13-6-7-15(35-13)11-27-21-31-17(23-2)30-18(24-3)32-21/h4-7H,8-11H2,1-3H3,(H4,22,25,26,28,29,33)(H3,23,24,27,30,31,32) |
| InChIKey | CDNKXESVICQWGR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 189.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |