C38H31OP — CID 130263902
3-(4-diphenylphosphorylphenyl)-1,7-dimethyl-7-(trideuteriomethyl)benzo[a]phenalene (PubChem CID 130263902) has the molecular formula C38H31OP and a molecular weight of 537.66 g/mol. Its IUPAC name is 3-(4-diphenylphosphorylphenyl)-1,7-dimethyl-7-(trideuteriomethyl)benzo[a]phenalene.
| Compound Name | 3-(4-diphenylphosphorylphenyl)-1,7-dimethyl-7-(trideuteriomethyl)benzo[a]phenalene |
|---|---|
| PubChem CID | 130263902 |
| Molecular Formula | C38H31OP |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 3-(4-diphenylphosphorylphenyl)-1,7-dimethyl-7-(trideuteriomethyl)benzo[a]phenalene |
| SMILES | [2H]C([2H])([2H])C1(C)c2ccccc2-c2c(C)cc(-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)c3cccc1c23 |
| InChI | InChI=1S/C38H31OP/c1-26-25-33(31-18-12-20-35-37(31)36(26)32-17-10-11-19-34(32)38(35,2)3)27-21-23-30(24-22-27)40(39,28-13-6-4-7-14-28)29-15-8-5-9-16-29/h4-25H,1-3H3/i2D3 |
| InChIKey | UTLSTLVJADJQBO-BMSJAHLVSA-N |
| XLogP | 8.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|