About CID 13026810
CID 13026810 (PubChem CID 13026810) has the molecular formula C8H13O4
and a molecular weight of 173.19 g/mol.
Molecular Properties
| Compound Name | CID 13026810 |
| PubChem CID | 13026810 |
| Molecular Formula | C8H13O4 |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(C)=C([O])OCC |
| InChI | InChI=1S/C8H13O4/c1-4-11-7(9)6(3)8(10)12-5-2/h4-5H2,1-3H3 |
| InChIKey | CHCVAQMIIUULML-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 13026810 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13026810?
The IUPAC name of CID 13026810 (CID 13026810) is not available.
What is the SMILES notation for CID 13026810?
The canonical SMILES for CID 13026810 is CCOC(=O)C(C)=C([O])OCC.
What is the InChIKey of CID 13026810?
The InChIKey is CHCVAQMIIUULML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O4/c1-4-11-7(9)6(3)8(10)12-5-2/h4-5H2,1-3H3.
What are the key properties of CID 13026810?
CID 13026810 has a molecular weight of 173.19 g/mol, XLogP of 1.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13026810 is sourced from PubChem (CID 13026810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).