C8H11F3O4 — CID 23264469
ethyl 3,3-dimethoxy-2-(trifluoromethyl)prop-2-enoate (PubChem CID 23264469) has the molecular formula C8H11F3O4 and a molecular weight of 228.17 g/mol. Its IUPAC name is ethyl 3,3-dimethoxy-2-(trifluoromethyl)prop-2-enoate.
| Compound Name | ethyl 3,3-dimethoxy-2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 23264469 |
| Molecular Formula | C8H11F3O4 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | ethyl 3,3-dimethoxy-2-(trifluoromethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=C(OC)OC)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O4/c1-4-15-6(12)5(8(9,10)11)7(13-2)14-3/h4H2,1-3H3 |
| InChIKey | FLEMCXSBBWOPMF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|