C29H33ClN6O7S — CID 130268205
tert-butyl 5-[2-[(5-chloro-2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-7-cyano-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate (PubChem CID 130268205) has the molecular formula C29H33ClN6O7S and a molecular weight of 645.14 g/mol. Its IUPAC name is tert-butyl 5-[2-[(5-chloro-2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-7-cyano-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 5-[2-[(5-chloro-2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-7-cyano-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 130268205 |
| Molecular Formula | C29H33ClN6O7S |
| Molecular Weight | 645.14 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | tert-butyl 5-[2-[(5-chloro-2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-7-cyano-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate |
| SMILES | COc1ncc(Cl)cc1Nc1nccc(-c2cc(C#N)c3c(c2)C(C)(COCCOS(C)(=O)=O)CN3C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C29H33ClN6O7S/c1-28(2,3)43-27(37)36-16-29(4,17-41-9-10-42-44(6,38)39)21-12-18(11-19(14-31)24(21)36)22-7-8-32-26(34-22)35-23-13-20(30)15-33-25(23)40-5/h7-8,11-13,15H,9-10,16-17H2,1-6H3,(H,32,34,35) |
| InChIKey | ZTZIAVODUBQLPK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.14 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|