C29H34N6O7S — CID 130268040
tert-butyl 7-cyano-5-[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate (PubChem CID 130268040) has the molecular formula C29H34N6O7S and a molecular weight of 610.69 g/mol. Its IUPAC name is tert-butyl 7-cyano-5-[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 7-cyano-5-[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 130268040 |
| Molecular Formula | C29H34N6O7S |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | tert-butyl 7-cyano-5-[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-3-methyl-3-(2-methylsulfonyloxyethoxymethyl)-2H-indole-1-carboxylate |
| SMILES | COc1ncccc1Nc1nccc(-c2cc(C#N)c3c(c2)C(C)(COCCOS(C)(=O)=O)CN3C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C29H34N6O7S/c1-28(2,3)42-27(36)35-17-29(4,18-40-12-13-41-43(6,37)38)21-15-19(14-20(16-30)24(21)35)22-9-11-32-26(33-22)34-23-8-7-10-31-25(23)39-5/h7-11,14-15H,12-13,17-18H2,1-6H3,(H,32,33,34) |
| InChIKey | AMRQVRZRAZUSMF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|