About CID 153471861
CID 153471861 (PubChem CID 153471861) has the molecular formula C28H31BN7O3
and a molecular weight of 524.41 g/mol.
Molecular Properties
| Compound Name | CID 153471861 |
| PubChem CID | 153471861 |
| Molecular Formula | C28H31BN7O3 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | — |
| SMILES | COc1ncccc1Nc1nccc(-c2cc(C#N)c3c(c2)C(C)(COCCN2CCCC2)CN3[B]C=O)n1 |
| InChI | InChI=1S/C28H31BN7O3/c1-28(18-39-13-12-35-10-3-4-11-35)17-36(29-19-37)25-21(16-30)14-20(15-22(25)28)23-7-9-32-27(33-23)34-24-6-5-8-31-26(24)38-2/h5-9,14-15,19H,3-4,10-13,17-18H2,1-2H3,(H,32,33,34) |
| InChIKey | PFZJQLYMCSUSCJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153471861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153471861?
The IUPAC name of CID 153471861 (CID 153471861) is not available.
What is the SMILES notation for CID 153471861?
The canonical SMILES for CID 153471861 is COc1ncccc1Nc1nccc(-c2cc(C#N)c3c(c2)C(C)(COCCN2CCCC2)CN3[B]C=O)n1.
What is the InChIKey of CID 153471861?
The InChIKey is PFZJQLYMCSUSCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31BN7O3/c1-28(18-39-13-12-35-10-3-4-11-35)17-36(29-19-37)25-21(16-30)14-20(15-22(25)28)23-7-9-32-27(33-23)34-24-6-5-8-31-26(24)38-2/h5-9,14-15,19H,3-4,10-13,17-18H2,1-2H3,(H,32,33,34).
What are the key properties of CID 153471861?
CID 153471861 has a molecular weight of 524.41 g/mol, XLogP of 3.16, 11 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153471861 is sourced from PubChem (CID 153471861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).