C29H31BClF3N5O3Si — CID 156662383
CID 156662383 (PubChem CID 156662383) has the molecular formula C29H31BClF3N5O3Si and a molecular weight of 628.94 g/mol.
| Compound Name | CID 156662383 |
|---|---|
| PubChem CID | 156662383 |
| Molecular Formula | C29H31BClF3N5O3Si |
| Molecular Weight | 628.94 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | — |
| SMILES | CC1(CO[Si](C)(C)C(C)(C)C)CN([B]C=O)c2c(C#N)cc(-c3ccnc(Nc4cc(Cl)ccc4OC(F)(F)F)n3)cc21 |
| InChI | InChI=1S/C29H31BClF3N5O3Si/c1-27(2,3)43(5,6)41-16-28(4)15-39(30-17-40)25-19(14-35)11-18(12-21(25)28)22-9-10-36-26(37-22)38-23-13-20(31)7-8-24(23)42-29(32,33)34/h7-13,17H,15-16H2,1-6H3,(H,36,37,38) |
| InChIKey | NFFADXCMFQAGTI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.94 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|