C31H43BN7O3Si — CID 153281585
CID 153281585 (PubChem CID 153281585) has the molecular formula C31H43BN7O3Si and a molecular weight of 600.63 g/mol.
| Compound Name | CID 153281585 |
|---|---|
| PubChem CID | 153281585 |
| Molecular Formula | C31H43BN7O3Si |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(Nc2nccc(-c3cc(C#N)c4c(c3)C(C)(CO[Si](C)(C)C(C)(C)C)CN4[B]C=O)n2)n(CCO)n1 |
| InChI | InChI=1S/C31H43BN7O3Si/c1-29(2,3)25-16-26(39(37-25)12-13-40)36-28-34-11-10-24(35-28)21-14-22(17-33)27-23(15-21)31(7,18-38(27)32-20-41)19-42-43(8,9)30(4,5)6/h10-11,14-16,20,40H,12-13,18-19H2,1-9H3,(H,34,35,36) |
| InChIKey | NUVNUTODIOSQON-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|