C32H43BClN8O2Si — CID 153281618
CID 153281618 (PubChem CID 153281618) has the molecular formula C32H43BClN8O2Si and a molecular weight of 646.10 g/mol.
| Compound Name | CID 153281618 |
|---|---|
| PubChem CID | 153281618 |
| Molecular Formula | C32H43BClN8O2Si |
| Molecular Weight | 646.10 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | — |
| SMILES | CN1CCC(Cn2nc(Cl)cc2Nc2nccc(-c3cc(C#N)c4c(c3)[C@@](C)(CO[Si](C)(C)C(C)(C)C)CN4[B]C=O)n2)CC1 |
| InChI | InChI=1S/C32H43BClN8O2Si/c1-31(2,3)45(6,7)44-20-32(4)19-41(33-21-43)29-24(17-35)14-23(15-25(29)32)26-8-11-36-30(37-26)38-28-16-27(34)39-42(28)18-22-9-12-40(5)13-10-22/h8,11,14-16,21-22H,9-10,12-13,18-20H2,1-7H3,(H,36,37,38)/t32-/m1/s1 |
| InChIKey | FMJJVEQUGJBJDS-JGCGQSQUSA-N |
| XLogP | 5.86 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.10 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|