C31H39BClN5O3PSi — CID 156662385
CID 156662385 (PubChem CID 156662385) has the molecular formula C31H39BClN5O3PSi and a molecular weight of 635.01 g/mol.
| Compound Name | CID 156662385 |
|---|---|
| PubChem CID | 156662385 |
| Molecular Formula | C31H39BClN5O3PSi |
| Molecular Weight | 635.01 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | — |
| SMILES | Cc1cc(P(C)(C)=O)c(Cl)cc1Nc1nccc(-c2cc(C#N)c3c(c2)[C@@](C)(CO[Si](C)(C)C(C)(C)C)CN3[B]C=O)n1 |
| InChI | InChI=1S/C31H39BClN5O3PSi/c1-20-12-27(42(6,7)40)24(33)15-26(20)37-29-35-11-10-25(36-29)21-13-22(16-34)28-23(14-21)31(5,17-38(28)32-19-39)18-41-43(8,9)30(2,3)4/h10-15,19H,17-18H2,1-9H3,(H,35,36,37)/t31-/m1/s1 |
| InChIKey | YIZXWYSLGHZNDB-WJOKGBTCSA-N |
| XLogP | 6.88 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.01 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|