C26H24BF3N5O3 — CID 156662245
CID 156662245 (PubChem CID 156662245) has the molecular formula C26H24BF3N5O3 and a molecular weight of 522.32 g/mol.
| Compound Name | CID 156662245 |
|---|---|
| PubChem CID | 156662245 |
| Molecular Formula | C26H24BF3N5O3 |
| Molecular Weight | 522.32 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | — |
| SMILES | CC(C)Oc1ccc(C(F)(F)F)cc1Nc1nccc(-c2cc(C#N)c3c(c2)C(C)(CO)CN3[B]C=O)n1 |
| InChI | InChI=1S/C26H24BF3N5O3/c1-15(2)38-22-5-4-18(26(28,29)30)10-21(22)34-24-32-7-6-20(33-24)16-8-17(11-31)23-19(9-16)25(3,13-36)12-35(23)27-14-37/h4-10,14-15,36H,12-13H2,1-3H3,(H,32,33,34) |
| InChIKey | ZWSOSODVHRUQFN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|