About CID 156662394
CID 156662394 (PubChem CID 156662394) has the molecular formula C25H24BFN5O4
and a molecular weight of 488.31 g/mol.
Molecular Properties
| Compound Name | CID 156662394 |
| PubChem CID | 156662394 |
| Molecular Formula | C25H24BFN5O4 |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | — |
| SMILES | COCCOc1cc(F)ccc1Nc1nccc(-c2cc(C#N)c3c(c2)[C@@](C)(CO)CN3[B]C=O)n1 |
| InChI | InChI=1S/C25H24BFN5O4/c1-25(14-33)13-32(26-15-34)23-17(12-28)9-16(10-19(23)25)20-5-6-29-24(30-20)31-21-4-3-18(27)11-22(21)36-8-7-35-2/h3-6,9-11,15,33H,7-8,13-14H2,1-2H3,(H,29,30,31)/t25-/m1/s1 |
| InChIKey | YZZAMOHDVXSIAX-RUZDIDTESA-N |
| XLogP | 2.80 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156662394 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156662394?
The IUPAC name of CID 156662394 (CID 156662394) is not available.
What is the SMILES notation for CID 156662394?
The canonical SMILES for CID 156662394 is COCCOc1cc(F)ccc1Nc1nccc(-c2cc(C#N)c3c(c2)[C@@](C)(CO)CN3[B]C=O)n1.
What is the InChIKey of CID 156662394?
The InChIKey is YZZAMOHDVXSIAX-RUZDIDTESA-N. The full InChI is InChI=1S/C25H24BFN5O4/c1-25(14-33)13-32(26-15-34)23-17(12-28)9-16(10-19(23)25)20-5-6-29-24(30-20)31-21-4-3-18(27)11-22(21)36-8-7-35-2/h3-6,9-11,15,33H,7-8,13-14H2,1-2H3,(H,29,30,31)/t25-/m1/s1.
What are the key properties of CID 156662394?
CID 156662394 has a molecular weight of 488.31 g/mol, XLogP of 2.80, 10 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156662394 is sourced from PubChem (CID 156662394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).