C33H38ClN5O5 — CID 130271123
tert-butyl 5-[2-[5-chloro-2-[2-(oxan-2-yloxy)ethoxy]anilino]pyrimidin-4-yl]-7-cyano-3,3-dimethyl-2H-indole-1-carboxylate (PubChem CID 130271123) has the molecular formula C33H38ClN5O5 and a molecular weight of 620.15 g/mol. Its IUPAC name is tert-butyl 5-[2-[5-chloro-2-[2-(oxan-2-yloxy)ethoxy]anilino]pyrimidin-4-yl]-7-cyano-3,3-dimethyl-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 5-[2-[5-chloro-2-[2-(oxan-2-yloxy)ethoxy]anilino]pyrimidin-4-yl]-7-cyano-3,3-dimethyl-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 130271123 |
| Molecular Formula | C33H38ClN5O5 |
| Molecular Weight | 620.15 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | tert-butyl 5-[2-[5-chloro-2-[2-(oxan-2-yloxy)ethoxy]anilino]pyrimidin-4-yl]-7-cyano-3,3-dimethyl-2H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C)c2cc(-c3ccnc(Nc4cc(Cl)ccc4OCCOC4CCCCO4)n3)cc(C#N)c21 |
| InChI | InChI=1S/C33H38ClN5O5/c1-32(2,3)44-31(40)39-20-33(4,5)24-17-21(16-22(19-35)29(24)39)25-11-12-36-30(37-25)38-26-18-23(34)9-10-27(26)41-14-15-43-28-8-6-7-13-42-28/h9-12,16-18,28H,6-8,13-15,20H2,1-5H3,(H,36,37,38) |
| InChIKey | KMKOPZSOLXNUEH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.15 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|