C11H22N2O2 — CID 130272126
N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylpentanamide (PubChem CID 130272126) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylpentanamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 130272126 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylpentanamide |
| SMILES | CCCC(C)(C)C(=O)NCC(=O)N(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-6-7-11(2,3)10(15)12-8-9(14)13(4)5/h6-8H2,1-5H3,(H,12,15) |
| InChIKey | BMMPABIFBNIHBA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |