C23H27N3O — CID 130272914
(E)-1-(4-methyl-2-phenylpiperazin-1-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-en-1-one (PubChem CID 130272914) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (E)-1-(4-methyl-2-phenylpiperazin-1-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methyl-2-phenylpiperazin-1-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 130272914 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (E)-1-(4-methyl-2-phenylpiperazin-1-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)/C=C/c2cccc3c2CCNC3)C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H27N3O/c1-25-14-15-26(22(17-25)19-6-3-2-4-7-19)23(27)11-10-18-8-5-9-20-16-24-13-12-21(18)20/h2-11,22,24H,12-17H2,1H3/b11-10+ |
| InChIKey | PVDGZISKYAPOIN-ZHACJKMWSA-N |
| XLogP | 2.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|