C20H21FN4O2 — CID 130273479
5-fluoro-N-[5-[(2-formyl-3-pyridinyl)amino]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide (PubChem CID 130273479) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 5-fluoro-N-[5-[(2-formyl-3-pyridinyl)amino]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide.
| Compound Name | 5-fluoro-N-[5-[(2-formyl-3-pyridinyl)amino]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130273479 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 5-fluoro-N-[5-[(2-formyl-3-pyridinyl)amino]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
| SMILES | O=Cc1ncccc1NC12CCCC(NC(=O)c3ccc(F)cn3)(CC1)C2 |
| InChI | InChI=1S/C20H21FN4O2/c21-14-4-5-16(23-11-14)18(27)25-20-7-2-6-19(13-20,8-9-20)24-15-3-1-10-22-17(15)12-26/h1,3-5,10-12,24H,2,6-9,13H2,(H,25,27) |
| InChIKey | HTBITDQJGNLJIU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|