C31H33N3O4 — CID 130274498
methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,6R)-6-ethynylmorpholin-2-yl]ethyl]phenyl]carbamate (PubChem CID 130274498) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,6R)-6-ethynylmorpholin-2-yl]ethyl]phenyl]carbamate.
| Compound Name | methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,6R)-6-ethynylmorpholin-2-yl]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 130274498 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,6R)-6-ethynylmorpholin-2-yl]ethyl]phenyl]carbamate |
| SMILES | C#C[C@@H]1CNC[C@@H](CCc2ccccc2N(C(=O)OC)C(=O)[C@@H](N)C(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C31H33N3O4/c1-3-25-20-33-21-26(38-25)19-18-22-12-10-11-17-27(22)34(31(36)37-2)30(35)29(32)28(23-13-6-4-7-14-23)24-15-8-5-9-16-24/h1,4-17,25-26,28-29,33H,18-21,32H2,2H3/t25-,26-,29+/m1/s1 |
| InChIKey | BDAWAQMCEQTIRA-GEBXHLAXSA-N |
| XLogP | 3.87 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|