C40H44N4O7 — CID 90279273
methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,5S)-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyloxymethyl]morpholin-2-yl]ethyl]phenyl]carbamate (PubChem CID 90279273) has the molecular formula C40H44N4O7 and a molecular weight of 692.81 g/mol. Its IUPAC name is methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,5S)-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyloxymethyl]morpholin-2-yl]ethyl]phenyl]carbamate.
| Compound Name | methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,5S)-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyloxymethyl]morpholin-2-yl]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 90279273 |
| Molecular Formula | C40H44N4O7 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | methyl N-[(2S)-2-amino-3,3-diphenylpropanoyl]-N-[2-[2-[(2R,5S)-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyloxymethyl]morpholin-2-yl]ethyl]phenyl]carbamate |
| SMILES | COC(=O)N(C(=O)[C@@H](N)C(c1ccccc1)c1ccccc1)c1ccccc1CC[C@@H]1CN[C@H](COC(=O)N[C@H]2c3ccccc3C[C@H]2O)CO1 |
| InChI | InChI=1S/C40H44N4O7/c1-49-40(48)44(38(46)36(41)35(27-13-4-2-5-14-27)28-15-6-3-7-16-28)33-19-11-9-12-26(33)20-21-31-23-42-30(24-50-31)25-51-39(47)43-37-32-18-10-8-17-29(32)22-34(37)45/h2-19,30-31,34-37,42,45H,20-25,41H2,1H3,(H,43,47)/t30-,31+,34+,36-,37-/m0/s1 |
| InChIKey | VBCYCVWCNFLACQ-MQTTWZJUSA-N |
| XLogP | 4.62 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |