C32H34F6N4O4 — CID 90279351
[(3S,6R)-6-[2-[2-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-6-(trifluoromethyl)phenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 90279351) has the molecular formula C32H34F6N4O4 and a molecular weight of 652.64 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[2-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-6-(trifluoromethyl)phenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[2-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-6-(trifluoromethyl)phenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 90279351 |
| Molecular Formula | C32H34F6N4O4 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | [(3S,6R)-6-[2-[2-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-6-(trifluoromethyl)phenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | N[C@H](C(=O)Nc1cccc(C(F)(F)F)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34F6N4O4/c33-31(34,35)19-41-30(44)46-18-22-17-45-23(16-40-22)14-15-24-25(32(36,37)38)12-7-13-26(24)42-29(43)28(39)27(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,22-23,27-28,40H,14-19,39H2,(H,41,44)(H,42,43)/t22-,23+,28-/m0/s1 |
| InChIKey | PQQMDYJOAJZQGN-JWZKTCGFSA-N |
| XLogP | 5.38 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |