C35H37F4N5O4 — CID 86578078
[(3S,6R)-6-[2-[3-[[(2S,3R)-2-amino-3-(4-fluorophenyl)-3-naphthalen-2-ylpropanoyl]amino]-5-methyl-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 86578078) has the molecular formula C35H37F4N5O4 and a molecular weight of 667.70 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[3-[[(2S,3R)-2-amino-3-(4-fluorophenyl)-3-naphthalen-2-ylpropanoyl]amino]-5-methyl-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[3-[[(2S,3R)-2-amino-3-(4-fluorophenyl)-3-naphthalen-2-ylpropanoyl]amino]-5-methyl-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 86578078 |
| Molecular Formula | C35H37F4N5O4 |
| Molecular Weight | 667.70 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | [(3S,6R)-6-[2-[3-[[(2S,3R)-2-amino-3-(4-fluorophenyl)-3-naphthalen-2-ylpropanoyl]amino]-5-methyl-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | Cc1cncc(NC(=O)[C@@H](N)[C@H](c2ccc(F)cc2)c2ccc3ccccc3c2)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1 |
| InChI | InChI=1S/C35H37F4N5O4/c1-21-15-41-17-30(29(21)13-12-28-16-42-27(18-47-28)19-48-34(46)43-20-35(37,38)39)44-33(45)32(40)31(23-8-10-26(36)11-9-23)25-7-6-22-4-2-3-5-24(22)14-25/h2-11,14-15,17,27-28,31-32,42H,12-13,16,18-20,40H2,1H3,(H,43,46)(H,44,45)/t27-,28+,31+,32-/m0/s1 |
| InChIKey | SWKDJQIYBQWHSC-HXUAJKRBSA-N |
| XLogP | 5.36 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |