C18H15Cl2F6N3O3 — CID 130274741
1-[2,6-dichloro-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea (PubChem CID 130274741) has the molecular formula C18H15Cl2F6N3O3 and a molecular weight of 506.23 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[2,6-dichloro-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 130274741 |
| Molecular Formula | C18H15Cl2F6N3O3 |
| Molecular Weight | 506.23 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 1-[2,6-dichloro-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea |
| SMILES | C[C@](O)(c1cc(Cl)c(NC(=O)NCc2ccc(OCC(F)(F)F)nc2)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C18H15Cl2F6N3O3/c1-16(31,18(24,25)26)10-4-11(19)14(12(20)5-10)29-15(30)28-7-9-2-3-13(27-6-9)32-8-17(21,22)23/h2-6,31H,7-8H2,1H3,(H2,28,29,30)/t16-/m0/s1 |
| InChIKey | QNABACVHRBDGDL-INIZCTEOSA-N |
| XLogP | 5.42 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.23 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |